PRODUCT Properties
| Boiling point: | 67-69 °C (24 mmHg) |
| Density | 2.29 |
| refractive index | 1.538-1.543 |
| Flash point: | 37°C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Soluble), Methanol (Sparingly) |
| Appearance | Colorless to light yellow Liquid |
| Sensitive | Light Sensitive |
| BRN | 1739037 |
| Stability: | Light Sensitive |
| Major Application | environmental |
| InChI | InChI=1S/C2HBr2N/c3-2(4)1-5/h2H |
| InChIKey | NDSBDLSWTGLNQA-UHFFFAOYSA-N |
| SMILES | C(#N)C(Br)Br |
| CAS DataBase Reference | 3252-43-5(CAS DataBase Reference) |
| IARC | 2B (Vol. 52, 71, 101) 2013 |
| EPA Substance Registry System | Dibromoacetonitrile (3252-43-5) |
Description and Uses
Dibromoacetonitrile is a carcinogenic nitrogenous disinfection byproduct. Dibromoacetonitrile in drinking water was linked to oral cavity cancer in rats and forestomach cancer in mice. In addition, Dibromoacetonitrile may cause oxidative damage in rat brain.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H319-H351-H410 |
| Precautionary statements | P201-P273-P301+P310+P330-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,T |
| Risk Statements | 20/21/22-36-22 |
| Safety Statements | 36/37-26 |
| RIDADR | 3275 |
| WGK Germany | 3 |
| RTECS | AL8450000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Irrit. 2 |
| Hazardous Substances Data | 3252-43-5(Hazardous Substances Data) |
