A1533212
2-Bromobenzophenone , >97.0%(GC) , 13047-06-8
Synonym(s):
(2-Bromophenyl)phenylmethanone
| Pack Size | Price | Stock | Quantity |
| 1G | RMB73.60 | In Stock |
|
| 5G | RMB207.20 | In Stock |
|
| 25g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42 |
| Boiling point: | 345 |
| Density | 1.4309 g/mL at 25 °C |
| refractive index | n20/D 1.6254 |
| Flash point: | 110 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to lump |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C13H9BrO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9H |
| InChIKey | ABEVIHIQUUXDMS-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1Br)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 13047-06-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H411 |
| Precautionary statements | P273 |
| Hazard Codes | Xi,N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29143990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 |






![(8-Bromo-3,4-dihydro-2H-benzo[b][1,4]dioxepin-7-yl)(phenyl)methanone](https://img.chemicalbook.com/CAS/GIF/175136-38-6.gif)