A1533912
2-Bromo-4'-(trifluoromethyl)acetophenone , >95.0%(GC) , 383-53-9
Synonym(s):
4-(Trifluoromethyl)phenacyl bromide
CAS NO.:383-53-9
Empirical Formula: C9H6BrF3O
Molecular Weight: 267.04
MDL number: MFCD00126489
EINECS: 609-544-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB156.80 | In Stock |
|
| 25G | RMB620.80 | In Stock |
|
| 100G | RMB1352.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45 °C |
| Boiling point: | 264.2±40.0 °C(Predicted) |
| Density | 1.592±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | 1S/C9H6BrF3O/c10-5-8(14)6-1-3-7(4-2-6)9(11,12)13/h1-4H,5H2 |
| InChIKey | HEMROKPXTCOASZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(cc1)C(=O)CBr |
| CAS DataBase Reference | 383-53-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | CORROSIVE |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






