A1541412
2-Benzoylacetanilide , >98.0%(N) , 959-66-0
CAS NO.:959-66-0
Empirical Formula: C15H13NO2
Molecular Weight: 239.27
MDL number: MFCD00003084
EINECS: 213-503-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB103.20 | In Stock |
|
| 5G | RMB375.20 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106-108 °C (lit.) |
| Boiling point: | 473.6±28.0 °C(Predicted) |
| Density | 1.205±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| solubility | acetone: soluble25mg/mL, clear, colorless to faintly yellow |
| pka | 11.37±0.23(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C15H13NO2/c17-14(12-7-3-1-4-8-12)11-15(18)16-13-9-5-2-6-10-13/h1-10H,11H2,(H,16,18) |
| InChIKey | XRZDIHADHZSFBB-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=CC=C1)(=O)CC(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 959-66-0(CAS DataBase Reference) |
Description and Uses
2-Benzoylacetanilide reacts with [PtCl2(cod)] (cod=cyclo-octa-1,5-diene), cis-[PtCl2(PPh3)2] (PPh3= triphenylphosphine) and [PdCl2(bipy)] (bipy=2,2′-bipyridine) to yield metallalactam complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 2 |
| RTECS | AB4542950 |
| HS Code | 2924.21.4500 |
| Storage Class | 13 - Non Combustible Solids |






