A1543412
Benzaldehyde 2,4-Dinitrophenylhydrazone , >98.0%(T) , 1157-84-2
Synonym(s):
Benzaldehyde-2,4-dinitrophenylhydrazone solution;Benzaldehyde-2,4-DNPH solution
CAS NO.:1157-84-2
Empirical Formula: C13H10N4O4
Molecular Weight: 286.24
MDL number: MFCD00156353
EINECS: 625-038-0
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB55.20 | In Stock |
|
| 1G | RMB180.00 | In Stock |
|
| 10G | RMB712.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-241 °C(lit.) |
| Boiling point: | 458.5±45.0 °C(Predicted) |
| Density | 1.39±0.1 g/cm3(Predicted) |
| Flash point: | 2℃ |
| storage temp. | 2-8°C |
| pka | 11.21±0.10(Predicted) |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | environmental |
| InChI | 1S/C13H10N4O4/c18-16(19)11-6-7-12(13(8-11)17(20)21)15-14-9-10-4-2-1-3-5-10/h1-9,15H/b14-9+ |
| InChIKey | DZPRPFUXOZTWAJ-NTEUORMPSA-N |
| SMILES | [O-][N+](=O)c1ccc(N\N=C\c2ccccc2)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 1157-84-2(CAS DataBase Reference) |
Description and Uses
Benzaldehyde-?2,?4-?dinitrophenylhydrazo?ne. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS02 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319-H302 |
| Precautionary statements | P210-P280-P305+P351+P338 |
| Hazard Codes | Xi,T,F,Xn |
| Risk Statements | 36/37/38-23/24/25-11-41-37/38-22-36-20/21/22 |
| Safety Statements | 26-36-45-27-16-39-36/37 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







