A1547312
3-Butynyl <i>p</i>-Toluenesulfonate , >97.0%(GC) , 23418-85-1
CAS NO.:23418-85-1
Empirical Formula: C11H12O3S
Molecular Weight: 224.28
MDL number: MFCD00041687
EINECS: 627-850-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB40.80 | In Stock |
|
| 1G | RMB76.80 | In Stock |
|
| 5G | RMB216.80 | In Stock |
|
| 25G | RMB780.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-45° |
| Boiling point: | 128°C 0,01mm |
| Density | 1.27 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >65°C |
| storage temp. | Refrigerator (+4°C) |
| solubility | Dichloromethane, Methanol |
| form | Liquid |
| Specific Gravity | 1.270 |
| color | Clear slightly yellow |
| BRN | 3304257 |
| InChI | 1S/C11H12O3S/c1-3-4-9-14-15(12,13)11-7-5-10(2)6-8-11/h1,5-8H,4,9H2,2H3 |
| InChIKey | STOASOOVVADOKH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)OCCC#C |
| CAS DataBase Reference | 23418-85-1(CAS DataBase Reference) |
Description and Uses
An organic sulfur compound, 3-Butynyl p-toluenesulfonate can be used for controlling harmful arthropod.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| HS Code | 29041000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







