BD7599331
Diethyl cyclobutane-1,1-dicarboxylate , 98% , 3779-29-1
CAS NO.：3779-29-1
Empirical Formula: C10H16O4
Molecular Weight: 200.23
MDL number: MFCD00019261
EINECS: 223-239-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB32.00 | In Stock |
|
| 25g | RMB62.40 | In Stock |
|
| 100g | RMB217.60 | In Stock |
|
| 500g | RMB951.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 104-105 °C12 mm Hg(lit.) |
| Density | 1.05 g/mL at 20 °C(lit.) |
| refractive index | 1.4360 |
| Flash point: | 89°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Dichloromethane, Methanol, |
| form | Oil |
| color | Colourless |
| Specific Gravity | 1.05 |
| Water Solubility | Insoluble in water. |
| BRN | 2050195 |
| InChI | InChI=1S/C10H16O4/c1-3-13-8(11)10(6-5-7-10)9(12)14-4-2/h3-7H2,1-2H3 |
| InChIKey | JPNJEJSZSMXWSV-UHFFFAOYSA-N |
| SMILES | C1(CCC1)(C(=O)OCC)C(=O)OCC |
| CAS DataBase Reference | 3779-29-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Diethyl 1,1-cyclobutanedicarboxylate(3779-29-1) |
| EPA Substance Registry System | 1,1-Cyclobutanedicarboxylic acid, diethyl ester (3779-29-1) |
Description and Uses
Diethyl cyclobutane-1,1-dicarboxylate may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P501a-P210-P280-P370+P378-P403+P235-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 38220090 |
