A4002712
Ethyl Cyclobutanecarboxylate , 98% , 14924-53-9
CAS NO.:14924-53-9
Empirical Formula: C7H12O2
Molecular Weight: 128.17
MDL number: MFCD00001321
EINECS: 238-995-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB124.80 | In Stock |
|
| 100G | RMB403.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 159 °C (lit.) |
| Density | 0.928 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 107 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1929653 |
| InChI | InChI=1S/C7H12O2/c1-2-9-7(8)6-4-3-5-6/h6H,2-5H2,1H3 |
| InChIKey | SMVBADCAMQOTOV-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)CCC1 |
| CAS DataBase Reference | 14924-53-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl cyclobutanecarboxylate(14924-53-9) |
Description and Uses
Ethyl cyclobutanecarboxylate can be used in the synthesis of cyclobutylidenecyclopropane by a three-step sequence.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P303+P361+P353-P403+P235 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 16-24/25 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29162090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





