A1564512
Bis(2,2,2-trifluoroethyl) (Methoxycarbonylmethyl)phosphonate , >95.0%(GC) , 88738-78-7
Synonym(s):
Bis(2,2,2-trifluoroethyl) (methoxycarbonylmethyl)phosphonate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB238.40 | In Stock |
|
| 5G | RMB656.00 | In Stock |
|
| 25G | RMB2468.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 246.6±40.0 °C(Predicted) |
| Density | 1.504 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear orange to dark orange-brown |
| Specific Gravity | 1.50 |
| BRN | 3594044 |
| InChI | InChI=1S/C7H9F6O5P/c1-16-5(14)2-19(15,17-3-6(8,9)10)18-4-7(11,12)13/h2-4H2,1H3 |
| InChIKey | PVSJXEDBEXYLML-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CP(OCC(F)(F)F)(OCC(F)(F)F)=O |
| CAS DataBase Reference | 88738-78-7(CAS DataBase Reference) |
Description and Uses
Methyl?P,P-bis(2,2,2-trifluoroethyl)phosphonoacetate can be used:
- In one of the key synthetic steps for the preparation of?trans-hydrindanes and (R)-(+)-umbelactone.
- To prepare a cis-olefinic ester derivative by Still–Gennari olefination of an aldehyde derivative using 18-crown ether and potassium bis(trimethylsilyl)amide (KHMDS).
- In the synthesis of (?)-(6S,2′S)-epi?cryptocaryalactone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![ETHYL 2-[BIS(2,2,2-TRIFLUOROETHYL)PHOSPHONO] PROPIONATE](https://img.chemicalbook.com/CAS/GIF/107905-52-2.gif)
