A1570312
5-Bromo-2-benzoxazolinone , >98.0% , 14733-73-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB212.00 | In Stock |
|
| 5G | RMB592.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218-222 °C(lit.) |
| Boiling point: | 10.85°C (rough estimate) |
| Density | 1.809 |
| refractive index | 1.6120 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 8.46±0.70(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C7H4BrNO2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
| InChIKey | DMHTZWJRUUOALC-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(Br)C=C2NC1=O |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | DM4950000 |
| HS Code | 2934.99.4400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
