A2590812
2-Chlorobenzoxazole , >98.0%(GC) , 615-18-9
CAS NO.:615-18-9
Empirical Formula: C7H4ClNO
Molecular Weight: 153.57
MDL number: MFCD00005766
EINECS: 210-414-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7 °C(lit.) |
| Boiling point: | 201-202 °C(lit.) |
| Density | 1.345 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Inert atmosphere,2-8°C |
| pka | 0.62±0.10(Predicted) |
| form | Powder |
| color | White |
| Water Solubility | Not miscible in water. |
| BRN | 115982 |
| InChI | InChI=1S/C7H4ClNO/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H |
| InChIKey | BBVQDWDBTWSGHQ-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2N=C1Cl |
| CAS DataBase Reference | 615-18-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoxazole, 2-chloro-(615-18-9) |
| EPA Substance Registry System | Benzoxazole, 2-chloro- (615-18-9) |
Description and Uses
2-Chlorobenzoxazole was used in the synthesis of 2-(2-naphthylamino)benzoxazole via reaction with 2-amino-1-naphthalenesulfonic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39-37/39-36 |
| WGK Germany | 3 |
| RTECS | DM4680000 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




