BD7630831
2,6-Dichlorobenzoxazole , 98% , 3621-82-7
CAS NO.:3621-82-7
Empirical Formula: C7H3Cl2NO
Molecular Weight: 188.01
MDL number: MFCD07368635
EINECS: 222-818-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB20.00 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB42.40 | In Stock |
|
| 25g | RMB80.00 | In Stock |
|
| 100g | RMB311.20 | In Stock |
|
| 500g | RMB1424.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 49-51°C |
| Boiling point: | 110°C/13mmHg(lit.) |
| Density | 1.522±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -0.96±0.30(Predicted) |
| form | fused solid |
| color | White |
| InChI | InChI=1S/C7H3Cl2NO/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H |
| InChIKey | LVVQTPZQNHQLOM-UHFFFAOYSA-N |
| SMILES | O1C2=CC(Cl)=CC=C2N=C1Cl |
| CAS DataBase Reference | 3621-82-7(CAS DataBase Reference) |
Description and Uses
2,6-Dichlorobenzoxazole is used in the synthesis of 2-(3-(2,6-dichloro-4-(3,3-dichloroallyloxy)phenoxy)propoxy)-5-(trifluoromethyl)benzo[d]oxazole, an insecticide against Spodoptera exigua.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







