A1576012
7-Bromoquinoline , >98.0%(GC)(T) , 4965-36-0
CAS NO.：4965-36-0
Empirical Formula: C9H6BrN
Molecular Weight: 208.05
MDL number: MFCD03695823
EINECS: 689-306-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB148.80 | In Stock |
|
| 25g | RMB516.00 | In Stock |
|
| 100g | RMB1880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-36℃ |
| Boiling point: | 290°C (rough estimate) |
| Density | 1.5617 (rough estimate) |
| refractive index | 1.6641 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Toluene |
| pka | 3.36±0.14(Predicted) |
| form | Solid |
| color | White to Orange to Green |
| λmax | 320nm(EtOH aq.)(lit.) |
| InChI | InChI=1S/C9H6BrN/c10-8-4-3-7-2-1-5-11-9(7)6-8/h1-6H |
| InChIKey | XYBSZCUHOLWQQU-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=C(Br)C=2)C=CC=1 |
| CAS DataBase Reference | 4965-36-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 7-bromoquinoline(4965-36-0) |
Description and Uses
7-Bromoquinoline is an organic intermediate that can be used to prepare 1,4-dihydroquinoline heterocyclic compounds. 1,4-Dihydroquinoline heterocyclic compounds are not only a very important class of organic synthesis intermediates, but also widely used in various drugs because of their bactericidal, anti-inflammatory, anti-tumor and other biopharmacological activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 29334900 |
