A3548612
3,4-Dihydro-6-hydroxy-2(1<i>H</i>)-quinolinone , >98.0%(HPLC)(N) , 54197-66-9
Synonym(s):
6-Hydroxy-1,2,3,4-tetrahydro-2-quinolinone;6-Hydroxy-3,4-dihydro-2(1H)-quinolinone;6-Hydroxy-3,4-dihydrocarbstyril
CAS NO.:54197-66-9
Empirical Formula: C9H9NO2
Molecular Weight: 163.17
MDL number: MFCD02179410
EINECS: 611-111-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB123.12 | In Stock |
|
| 100G | RMB355.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236-240 °C |
| Boiling point: | 424.5±45.0 °C(Predicted) |
| Density | 1.282±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | solid |
| pka | 9.86±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C9H9NO2/c11-7-2-3-8-6(5-7)1-4-9(12)10-8/h2-3,5,11H,1,4H2,(H,10,12) |
| InChIKey | HOSGXJWQVBHGLT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(O)C=C2)CCC1=O |
| CAS DataBase Reference | 54197-66-9(CAS DataBase Reference) |
Description and Uses
A metabolite of Cilostazole.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933790002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |






