A4799412
6-Hydroxy-1-tetralone , >98.0% , 3470-50-6
Synonym(s):
6-Hydroxy-1-tetralone
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5G | RMB56.00 | In Stock |
|
| 10g | RMB100.40 | In Stock |
|
| 25G | RMB196.80 | In Stock |
|
| 100G | RMB737.60 | In Stock |
|
| 500g | RMB2687.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-157 °C(lit.) |
| Boiling point: | 358.0±31.0 °C(Predicted) |
| Density | 1.236±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 8.22±0.20(Predicted) |
| form | Crystalline Powder |
| color | Off-white to brown |
| InChI | InChI=1S/C10H10O2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6,11H,1-3H2 |
| InChIKey | FNSQPQKPPGALFA-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(O)C=C2)CCC1 |
| CAS DataBase Reference | 3470-50-6(CAS DataBase Reference) |
Description and Uses
6-Hydroxy-3,4-dihydro-1(2H)-naphthalenone (6-Hydroxy-1-tetralone) may be used in the synthesis of:
- 5-chloromethyl-6-hydroxy-3,4-dihydro-1(2H)-naphthalenone
- 6-(4-(3-(piperidin-1-yl)propoxy)benzyloxy)-1-tetralone
- 6-(3-(piperidin-1-yl)propoxy)-1-tetralone
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







