A1580712
(2-Benzothiazolylthio)acetic Acid , >98.0% , 6295-57-4
CAS NO.:6295-57-4
Empirical Formula: C9H7NO2S2
Molecular Weight: 225.29
MDL number: MFCD00227391
EINECS: 228-565-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB60.80 | In Stock |
|
| 25G | RMB149.60 | In Stock |
|
| 100G | RMB378.40 | In Stock |
|
| 500G | RMB1591.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159°C |
| Boiling point: | 423.4±47.0 °C(Predicted) |
| Density | 1.4374 (rough estimate) |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | 1.5364 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Insoluble in water |
| form | powder to crystal |
| pka | 3.23±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | 133mg/L at 20℃ |
| InChI | InChI=1S/C9H7NO2S2/c11-8(12)5-13-9-10-6-3-1-2-4-7(6)14-9/h1-4H,5H2,(H,11,12) |
| InChIKey | ZZUQWNYNSKJLPI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CSC1=NC2=CC=CC=C2S1 |
| LogP | 1.6 at 20℃ |
| CAS DataBase Reference | 6295-57-4(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, (2-benzothiazolylthio)- (6295-57-4) |
Description and Uses
(1,3-benzothiazol-2-ylthio)acetic acid is a useful research chemical.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2934208090 |




![2-(Benzo[d]thiazol-2-ylthio)succinicacid](https://img.chemicalbook.com/CAS/GIF/95154-01-1.gif)

