PRODUCT Properties
| Boiling point: | 109°C/10mmHg(lit.) |
| Density | 1.649±0.06 g/cm3(Predicted) |
| refractive index | 1.6600-1.6640 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C8H5BrS/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5H |
| InChIKey | NOICDPBEDNMHQK-UHFFFAOYSA-N |
| SMILES | C12=C(Br)C=CC=C1C=CS2 |
Description and Uses
7-Bromobenzo[b]thiophene is a useful research chemical used in the preparation of di(chloro)-N-[(benzo[b]thienyl)sulfonyl]benzamide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |

![7-Bromobenzo[<i>b</i>]thiophene](https://img.chemicalbook.com/CAS/GIF/1423-61-6.gif)

![7-Bromobenzo[d]thiazol-2(3H)-one](https://img.chemicalbook.com/CAS/20150408/GIF/1188047-07-5.gif)

![Methyl 7-bromobenzo[b]thiophene-2-carboxylate](https://img.chemicalbook.com/StructureFile/ChemBookStructure21/GIF/CB2798383.gif)