A1593712
7-Bromo-2-naphthol , >97.0%(GC) , 116230-30-9
CAS NO.:116230-30-9
Empirical Formula: C10H7BrO
Molecular Weight: 223.07
MDL number: MFCD00277644
EINECS: 628-835-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25g | RMB279.20 | In Stock |
|
| 100g | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-138 °C |
| Boiling point: | 353.8±15.0 °C(Predicted) |
| Density | 1.614±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| pka | 9.17±0.40(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C10H7BrO/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-6,12H |
| InChIKey | VWSBGGRCEQOTNU-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC(Br)=C2)=CC=C1O |
| CAS DataBase Reference | 116230-30-9 |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






