A1600050
Sorbidenitrate , BR , 87-33-2
Synonym(s):
ISDN
CAS NO.:87-33-2
Empirical Formula: C6H8N2O8
Molecular Weight: 236.14
MDL number: MFCD00868238
EINECS: 201-740-9
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB55.20 | In Stock |
|
| 25mg | RMB183.20 | In Stock |
|
| 100mg | RMB399.20 | In Stock |
|
| 500mg | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 700C |
| alpha | D20 +135° (alc) |
| Boiling point: | 378.59°C (rough estimate) |
| Density | 1.7503 (rough estimate) |
| refractive index | 1.5010 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Undiluted isosorbide dinitrate is very slightly soluble in water, very soluble in acetone, sparingly soluble in ethanol (96 per cent). The solubility of the diluted product depends on the diluent and its concentration. |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 549.7mg/L(25 ºC) |
| BCS Class | 3 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C6H8N2O8/c9-7(10)15-3-1-13-6-4(16-8(11)12)2-14-5(3)6/h3-6H,1-2H2 |
| InChIKey | MOYKHGMNXAOIAT-JGWLITMVSA-N |
| SMILES | [H][C@@]1([C@@]([H])(O[N+]([O-])=O)CO2)[C@@]2([H])[C@]([H])(O[N+]([O-])=O)CO1 |
| LogP | 1.31 at 25℃ |
| CAS DataBase Reference | 87-33-2(CAS DataBase Reference) |
| EPA Substance Registry System | D-Glucitol, 1,4:3,6-dianhydro-, dinitrate (87-33-2) |
Description and Uses
Isosorbide dinitrate is also used in chronic cardiac insufficiency for preventing angina pectoris attacks. It is a long-lasting drug.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H207-H302 |
| Precautionary statements | P210-P212-P230-P233-P280-P370+P380+P375-P501 |
| Hazard Codes | Xn |
| Risk Statements | 5-22 |
| Safety Statements | 36 |
| RIDADR | UN 2907 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 2932999000 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Desen. Expl. 3 |
| Hazardous Substances Data | 87-33-2(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 747mg/kg |






