A7691758
Isosorbide , 10mMinDMSO , 652-67-5
Synonym(s):
(-)-1,1′,6,6′,7,7′-Hexahydroxy-3,3′-dimethyl-5,5′-bis(1-methylethyl)-[2,2′-binaphthalene]-8,8′-dicarboxaldehyde;(R)-(-)-gossypol;(R)-1,1′,6,6′,7,7′-Hexahydroxy-3,3′-dimethyl-5,5′-bis(1-methylethyl)-[2,2′-binaphthalene]-8,8′-dicarboxaldehyde;(R)-Gossypol;D -Isosorbide
CAS NO.:652-67-5
Empirical Formula: C6H10O4
Molecular Weight: 146.14
MDL number: MFCD00064827
EINECS: 211-492-3
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-63 °C (lit.) |
| Boiling point: | 175°C/2mmHg(lit.) |
| alpha | 42 º (c=3, H2O) |
| Density | 1.0945 (rough estimate) |
| vapor pressure | 0.007Pa at 20℃ |
| refractive index | 45 ° (C=5, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| pka | 13.17±0.40(Predicted) |
| form | Crystals, Crystalline Solid or Mass |
| color | Off-white to light yellow or beige |
| optical activity | [α]20/D +45.2°, c = 3 in H2O |
| Water Solubility | Soluble in alcohols, water and ketones. |
| Sensitive | Hygroscopic |
| Merck | 14,5224 |
| BRN | 80510 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING HUMECTANT |
| InChI | 1S/C6H10O4/c7-3-1-9-6-4(8)2-10-5(3)6/h3-8H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | KLDXJTOLSGUMSJ-JGWLITMVSA-N |
| SMILES | O[C@H]1CO[C@@H]2[C@H](O)CO[C@H]12 |
| LogP | -1.39 at 20℃ |
| CAS DataBase Reference | 652-67-5(CAS DataBase Reference) |
| EPA Substance Registry System | D-Glucitol, 1,4:3,6-dianhydro- (652-67-5) |
Description and Uses
pharmaceutical intermediate for dimethyl ether and mono- and dinitrate derivatives; the nitrate esters find use as vasodilators and coronary disease therapeutics.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P501-P210-P280-P370+P378-P403+P235 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22 |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | LZ4380000 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 652-67-5(Hazardous Substances Data) |





