A1600512
Benzo[<i>b</i>]naphtho[1,2-<i>d</i>]thiophene , >98.0% , 205-43-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB268.80 | In Stock |
|
| 5G | RMB1216.80 | In Stock |
|
| 10g | RMB1930.40 | In Stock |
|
| 25g | RMB3552.80 | In Stock |
|
| 50g | RMB5119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185℃ (acetic acid ) |
| Boiling point: | 220°C/0.2mmHg(lit.) |
| Density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| color | White to Orange to Green |
| λmax | 351nm(CHCl3)(lit.) |
| BRN | 9635 |
| InChI | InChI=1S/C16H10S/c1-2-6-12-11(5-1)9-10-15-16(12)13-7-3-4-8-14(13)17-15/h1-10H |
| InChIKey | XZUMOEVHCZXMTR-UHFFFAOYSA-N |
| SMILES | C12=CC=CC=C1C1=C3C(C=CC=C3)=CC=C1S2 |
| EPA Substance Registry System | Benzo[b]naphtho[1,2-d]thiophene (205-43-6) |
Safety
| RTECS | DI2340000 |
| HS Code | 2934.99.4400 |

![Benzo[<i>b</i>]naphtho[1,2-<i>d</i>]thiophene](https://img.chemicalbook.com/CAS/GIF/205-43-6.gif)



![Benzo[b]thiophene](https://img.chemicalbook.com/CAS/GIF/95-15-8.gif)