A1605712
1,4-Benzodioxane-2-carboxylic Acid , >98.0% , 3663-80-7
Synonym(s):
1,4-Benzodioxan-2-carboxylic acid
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB139.20 | In Stock |
|
| 100G | RMB485.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-130 °C(lit.) |
| Boiling point: | 347.2±41.0 °C(Predicted) |
| Density | 1.379±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.69±0.20(Predicted) |
| color | White to Off-White |
| Water Solubility | 7.63g/L at 20℃ |
| λmax | 282nm(MeOH)(lit.) |
| InChI | InChI=1S/C9H8O4/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2,(H,10,11) |
| InChIKey | HMBHAQMOBKLWRX-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OCC1C(O)=O |
| LogP | 0.5 at 20℃ |
| CAS DataBase Reference | 3663-80-7(CAS DataBase Reference) |
Description and Uses
These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29329990 |







