A1609112
Bis(2,4-pentanedionato)tin(IV) Dichloride , >98.0%(T) , 16919-46-3
Synonym(s):
Bis(acetylacetonato)dichlorotin;Dichlorotin bis(acetylacetonate)
CAS NO.:16919-46-3
Empirical Formula: C10H14Cl2O4Sn
Molecular Weight: 387.83
MDL number: MFCD00015316
EINECS: 240-972-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB343.20 | In Stock |
|
| 25G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 204-206 °C(lit.) |
| Boiling point: | 202-3°C |
| storage temp. | Room Temperature |
| solubility | Soluble in organic solvents. |
| form | Crystalline |
| color | Light Beige |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/2C5H8O2.2ClH.Sn/c2*1-4(6)3-5(2)7;;;/h2*3,6H,1-2H3;2*1H;/q;;;;+4/p-4/b2*4-3-;;; |
| InChIKey | DTMARTPDQMQTRX-VGKOASNMSA-J |
| SMILES | CC(=O)\C=C(\C)O[Sn](Cl)(Cl)O\C(C)=C/C(C)=O |
Description and Uses
Tin(IV) Chloride Bis(2,4-pentanedionate) is used in the synthesis of nanoplate building blocks. Also used in the synthesis of Schiff’s base ligands.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H314-H351 |
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-34-40 |
| Safety Statements | 26-27-28-36/37/39 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 2931.90.9029 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Skin Corr. 1B |






