PRODUCT Properties
| Melting point: | 169.0 to 173.0 °C |
| Boiling point: | 362.6±44.0 °C(Predicted) |
| Density | 1.729±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -3.33±0.20(Predicted) |
| color | White to Yellow to Orange |
| InChI | 1S/C9H6BrNO2/c1-11-7-3-2-5(10)4-6(7)8(12)9(11)13/h2-4H,1H3 |
| InChIKey | GEEDYJPPYNIZLX-UHFFFAOYSA-N |
| SMILES | O=C(C1=CC(Br)=CC=C1N2C)C2=O |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| WGK Germany | WGK 3 |
| RTECS | NL7878000 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
