A1616750
O-Allyl-1-(anthracen-9-ylmethyl)cinchonidiniumbromide , 95% , 200132-54-3
CAS NO.：200132-54-3
Empirical Formula: C37H37BrN2O
Molecular Weight: 605.61
MDL number: MFCD01632446
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB84.80 | In Stock |
|
| 1g | RMB372.00 | In Stock |
|
| 5g | RMB748.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170 °C (dec.)(lit.) |
| alpha | -340 º (C=0.45 IN CHLOROFORM) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | Light yellow to light brown Solid |
| optical activity | [α]20/D 345±30°, c = 0.45 in chloroform |
| InChIKey | QOWNPAUSLGATNL-JNKXQCINSA-M |
| SMILES | [Br-].[H][C@@]12CC[N+](C[C@@H]1C=C)(Cc3c4ccccc4cc5ccccc35)[C@@]([H])(C2)[C@H](OCC=C)c6ccnc7ccccc67 |
Description and Uses
O-Allyl-N-(9-anthracenylmethyl)cinchonidinium bromide can catalyze the asymmetric alkylation of tert-butyl glycinate-benzophenone Schiff base with different arylmethyl bromides in a micellar medium.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
