A1622650
6-Hydroxyhexanoicacid , 95% , 1191-25-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB103.20 | In Stock |
|
| 1g | RMB207.20 | In Stock |
|
| 5g | RMB856.00 | In Stock |
|
| 25g | RMB3800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40 °C |
| Boiling point: | 113-116 °C |
| Density | 0.981 |
| refractive index | 1.44 |
| Flash point: | >110°C |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| form | Low Melting Crystalline Solid |
| pka | 4.75±0.10(Predicted) |
| color | White |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9) |
| InChIKey | IWHLYPDWHHPVAA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCO |
| LogP | -0.191 (est) |
Description and Uses
6-Hydroxyhexanoic acid acts as a useful reagent in synthetic chemistry. It is used as a precursor to prepare surface active monomers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 24/25-45-36/37/39-26-23 |
| RIDADR | UN 1760 8/PG 2 |
| HS Code | 29181998 |
