A1623612
5-Bromo-2,2'-bithiophene-5'-carboxaldehyde , >98.0%(HPLC) , 110046-60-1
Synonym(s):
5′-Bromo-[2,2′]bithiophene-5-carboxaldehyde;5′-Bromo-2,2′-bithienyl-5-carboxaldehyde;5′-Bromo-2,2′-bithiophene-5-carbaldehyde
CAS NO.:110046-60-1
Empirical Formula: C9H5BrOS2
Molecular Weight: 273.17
MDL number: MFCD01321134
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB143.20 | In Stock |
|
| 1G | RMB399.20 | In Stock |
|
| 5G | RMB1317.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145.0 to 149.0 °C |
| Boiling point: | 368.7±42.0 °C(Predicted) |
| Density | 1.691±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | Green to Dark green |
| InChI | 1S/C9H5BrOS2/c10-9-4-3-8(13-9)7-2-1-6(5-11)12-7/h1-5H |
| InChIKey | NTHMTYNJFSUBMF-UHFFFAOYSA-N |
| SMILES | BrC1=CC=C(C2=CC=C(C([H])=O)S2)S1 |
| CAS DataBase Reference | 110046-60-1 |
Description and Uses
5''-Bromo-2,2''-bithiophene-5-carbaldehyde acts as a reagent in the synthesis of carbazole based sensitizers for efficient dye-sensitized solar cells.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36/37-45-24/25 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |




![7-Bromo-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/852054-42-3.gif)

