A1624212
(+)-3-Bromocamphor , >98.0%(GC) , 10293-06-8
Synonym(s):
endo-(1R)-3-Bromo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
CAS NO.:10293-06-8
Empirical Formula: C10H15BrO
Molecular Weight: 231.13
MDL number: MFCD00003744
EINECS: 233-652-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB431.20 | In Stock |
|
| 500G | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-78 °C(lit.) |
| Boiling point: | 274 °C |
| alpha | 130 º (c=5, CH3OH) |
| Density | 1.2896 (rough estimate) |
| refractive index | 137.5 ° (C=2, EtOH) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline |
| color | White |
| optical activity | [α]20/D +136±3°, c = 1% in ethanol |
| Sensitive | Light Sensitive |
| Merck | 14,1414 |
| BRN | 3197237 |
| InChI | 1S/C10H15BrO/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6-7H,4-5H2,1-3H3/t6-,7+,10+/m1/s1 |
| InChIKey | NJQADTYRAYFBJN-FWWHASMVSA-N |
| SMILES | [H][C@@]12CC[C@@](C)(C(=O)[C@H]1Br)C2(C)C |
| CAS DataBase Reference | 10293-06-8(CAS DataBase Reference) |
| NIST Chemistry Reference | ((1R)-endo)-(+)-3-bromocamphor(10293-06-8) |
Description and Uses
Medicine, manufacture of camphor derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | ED6750000 |
| F | 8-10 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![((1S,3S,4S)-3-Bromo-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonicacidhydrate](https://img.chemicalbook.com/CAS/GIF/209736-59-4.gif)


