PRODUCT Properties
| Melting point: | 160-165 °C |
| Boiling point: | 420.7±18.0 °C(Predicted) |
| Density | 1.508±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.84±0.10(Predicted) |
| color | Light yellow to Brown |
| BRN | 159526 |
| InChI | InChI=1S/C14H10BrN/c15-9-12-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8H,9H2 |
| InChIKey | MZFYKBHQWLWIBI-UHFFFAOYSA-N |
| SMILES | C1C2C(=NC3C(C=2CBr)=CC=CC=3)C=CC=1 |
Description and Uses
9-(Bromomethyl)acridine is an HPLC derivatizing agent used for fluorescent labeling of carboxylic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |

![9-(Bromomethyl)acridine [for HPLC Labeling]](https://img.chemicalbook.com/CAS/GIF/1556-34-9.gif)

![(S)-(+)-DBD-APy [=(S)-(+)-4-(N,N-Dimethylaminosulfonyl)-7-(3-aminopyrrolidin-1-yl)-2,1,3-benzoxadiazole] [HPLC Labeling Reagent for e.e. Determination]](https://img.chemicalbook.com/CAS/GIF/143112-50-9.gif)


