A1638412
5-Bromo-1-methyl-1<I>H</I>-imidazole , 97% , 1003-21-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB237.60 | In Stock |
|
| 100g | RMB929.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-44 °C (lit.) |
| Boiling point: | 120°C 15mm |
| Density | 1.69±0.1 g/cm3(Predicted) |
| Flash point: | 180 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 5.25±0.10(Predicted) |
| form | crystals |
| color | Colourless/white |
| InChI | InChI=1S/C4H5BrN2/c1-7-3-6-2-4(7)5/h2-3H,1H3 |
| InChIKey | HATLLUIOEIXWGD-UHFFFAOYSA-N |
| SMILES | C1N(C)C(Br)=CN=1 |
| CAS DataBase Reference | 1003-21-0(CAS DataBase Reference) |
Description and Uses
5-Bromo-1-methyl-1H-imidazole is an ether that inhibits the farnesyltransferase enzyme. It also inhibits the activity of other enzymes such as dimethyl dioxan disulphide and alkylation inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HS Code | 29332900 |
