A1641712
2-<WBR>Bromoisobutyrophenone , 97% , 10409-54-8
Synonym(s):
2-Bromo-2-methylpropiophenone
CAS NO.:10409-54-8
Empirical Formula: C10H11BrO
Molecular Weight: 227.1
MDL number: MFCD00000124
EINECS: 233-879-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB375.20 | In Stock |
|
| 25G | RMB1487.20 | In Stock |
|
| 100G | RMB4751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 146-148 °C30 mm Hg(lit.) |
| Density | 1.35 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C10H11BrO/c1-10(2,11)9(12)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | QMOSZSHTSOWPRX-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)C(Br)(C)C |
| CAS DataBase Reference | 10409-54-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-37/39 |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29147000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |






