A1644850
Tributyl(1-ethoxyvinyl)tin , 95% , 97674-02-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB64.80 | In Stock |
|
| 25g | RMB219.20 | In Stock |
|
| 100g | RMB780.80 | In Stock |
|
| 500g | RMB3692.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 85-86 °C0.1 mm Hg(lit.) |
| Density | 1.069 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Choroform (Slightly), Ethyl Acetate (Slightly) |
| form | liquid |
| color | colorless |
| Specific Gravity | 1.069 |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C4H7O.3C4H9.Sn/c1-3-5-4-2;3*1-3-4-2;/h1,4H2,2H3;3*1,3-4H2,2H3; |
| InChIKey | HGXJOXHYPGNVNK-UHFFFAOYSA-N |
| SMILES | [Sn](CCCC)(CCCC)(CCCC)C(OCC)=C |
Description and Uses
Electrophilic methyl ketone equivalent used in a recent synthesis of a 13-oxophorbine (chlorophyll) from the corresponding 13-bromochlorin.
Safety
| Symbol(GHS) |    GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H372-H400 |
| Precautionary statements | P273-P301+P310+P330-P302+P352-P305+P351+P338-P314 |
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29319090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
