M2736747
cis-Tributyl(2-ethoxyethenyl)stannane , 95% , 64724-29-4
Synonym(s):
(Z)-Tributyl[2-ethoxyethenyl]stannane;cis-1-Ethoxy-2-(tributylstannyl)ethylene;Tributyl((Z)-2-ethoxyvinyl)stannane
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB542.40 | In Stock |
|
| 1g | RMB1430.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-87℃ |
| Density | 1.082 |
| refractive index | n20/D1.479 |
| Flash point: | >110℃ |
| storage temp. | 2-8°C |
| solubility | sol THF, DMF, MeCN. |
| form | liquid |
| Water Solubility | Soluble in water. |
| Boiling point: | 84-87°C/1 mmHg |
| InChI | 1S/C4H7O.3C4H9.Sn/c1-3-5-4-2;3*1-3-4-2;/h1,3H,4H2,2H3;3*1,3-4H2,2H3; |
| InChIKey | WARKYKQCOXTIAO-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)\C=C/OCC |
Description and Uses
1-Ethoxy-2-(tributylstannyl)ethene is a versatile synthon for acetaldehyde anion.
cis-1-Ethoxy-2-(tri-n-butylstannyl)ethylene is widely used in pharmaceutical research and as reagent.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H360FD-H372-H410 |
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2931200000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |






