A1664012
5-<WBR>Bromo-<WBR>2,4-<WBR>dimethoxybenzaldehyde , 95% , 130333-46-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB207.20 | In Stock |
|
| 5G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-141 °C (lit.) |
| Boiling point: | 344.3±37.0 °C(Predicted) |
| Density | 1.482±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C9H9BrO3/c1-12-8-4-9(13-2)7(10)3-6(8)5-11/h3-5H,1-2H3 |
| InChIKey | PXDIELLGFUEAIX-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(Br)=C(OC)C=C1OC |
Description and Uses
5-Bromo-2,4-dimethoxybenzaldehyde has been used in the preparation of 1,2-dihydro-4,6-dimethoxy-3-methylbenzocyclobuten-1-ol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
