A1672912
4-<WBR>Boc-<WBR>1-<WBR>(5-<WBR>bromo-<WBR>2-<WBR>pyridyl)<WBR>piperazine , 97% , 153747-97-8
CAS NO.：153747-97-8
Empirical Formula: C14H20BrN3O2
Molecular Weight: 342.23
MDL number: MFCD07369772
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB47.20 | In Stock |
|
| 1G | RMB76.00 | In Stock |
|
| 5G | RMB192.80 | In Stock |
|
| 25G | RMB587.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-87 °C (lit.) |
| Boiling point: | 433.0±45.0 °C(Predicted) |
| Density | 1.372±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 6.06±0.29(Predicted) |
| form | Powder |
| color | White to yellow |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C14H20BrN3O2/c1-14(2,3)20-13(19)18-8-6-17(7-9-18)12-5-4-11(15)10-16-12/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | DSLVSFMWCDGZIL-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCN(C2=NC=C(Br)C=C2)CC1 |
Description and Uses
4-Boc-1-(5-bromo-2-pyridyl)piperazine is used as active pharmaceutical ingredient.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P280a-P301+P310a-P405-P501a-P261-P301+P310-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2933599590 |
