A1676312
2-Bromo-1-methyl-1<I>H</I>-imidazole , 95% , 16681-59-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.00 | In Stock |
|
| 1G | RMB123.20 | In Stock |
|
| 5G | RMB405.60 | In Stock |
|
| 25g | RMB1720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 172 °C (lit.) |
| Density | 1.649 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Liquid |
| pka | 3.83±0.25(Predicted) |
| color | Clear colorless to pale yellow to pink |
| InChI | InChI=1S/C4H5BrN2/c1-7-3-2-6-4(7)5/h2-3H,1H3 |
| InChIKey | BANOTGHIHYMTDL-UHFFFAOYSA-N |
| SMILES | C1(Br)N(C)C=CN=1 |
| CAS DataBase Reference | 16681-59-7(CAS DataBase Reference) |
Description and Uses
2-Bromo-1-methylimidazole is used in in pharmaceuticals, drug candidates, ligands for transition metal catalysts and other molecular functional materials.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-38-41 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29332990 |
