A1682112
2-Bromopropionitrile , 95% , 19481-82-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB319.20 | In Stock |
|
| 5G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 68-69 °C/50 mmHg (lit.) |
| Density | 1.55 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 137 °F |
| storage temp. | Storage temp. -20°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C3H4BrN/c1-3(4)2-5/h3H,1H3 |
| InChIKey | PYNYHMRMZOGVML-UHFFFAOYSA-N |
| SMILES | C(#N)C(Br)C |
Description and Uses
2-Bromopropionitrile was used as an initiator in the atom transfer radical polymerization using activators generated by electron transfer (AGET ATRP) of acrylonitrile and the reaction was catalysed by Yb-based catalyst.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-26-28-36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
