A1706212
2,6-<WBR>Bis(trifluoromethyl)<WBR>pyridine , 97% , 455-00-5
CAS NO.:455-00-5
Empirical Formula: C7H3F6N
Molecular Weight: 215.1
MDL number: MFCD00236675
EINECS: 622-745-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB156.00 | In Stock |
|
| 1G | RMB430.40 | In Stock |
|
| 5g | RMB1559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C |
| Boiling point: | 82 °C 18 mm Hg |
| Density | 1.437±0.06 g/cm3(Predicted) |
| Flash point: | 153 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| pka | -4.12±0.24(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 188806 |
| InChI | InChI=1S/C7H3F6N/c8-6(9,10)4-2-1-3-5(14-4)7(11,12)13/h1-3H |
| InChIKey | YPDVFTXBESQIPJ-UHFFFAOYSA-N |
| SMILES | C1(C(F)(F)F)=NC(C(F)(F)F)=CC=C1 |
| CAS DataBase Reference | 455-00-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS06 |
| Signal word | Danger |
| Hazard statements | H228-H301-H315-H319-H335 |
| Precautionary statements | P210-P240-P241-P301+P310-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | F,T,Xi |
| Risk Statements | 11-25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2926 4.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, TOXIC |
| HS Code | 29333990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 Kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







