A1706612
Benz[<I>g</I>]<WBR>isoquinoline-<WBR>5,10-<WBR>dione , 99% , 46492-08-4
Synonym(s):
2-Aza-9,10-anthraquinone
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB367.20 | In Stock |
|
| 25MG | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-180 °C(lit.) |
| Boiling point: | 407℃ |
| Density | 1.373 |
| Flash point: | 202℃ |
| pka | 1.10±0.20(Predicted) |
| InChI | 1S/C13H7NO2/c15-12-8-3-1-2-4-9(8)13(16)11-7-14-6-5-10(11)12/h1-7H |
| InChIKey | ZLLVUAAESHIVAZ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c3cnccc13 |
Description and Uses
Benz[g]isoquinoline-5,10-dione, an active component isolated from the ethanolic extract of the aerial parts of Mitracarpus scaber, demonstrates notable in vitro inhibitory activity against AIDS-related pathogens, along with significant antibacterial and antifungal properties, as evidenced by the agar well-diffusion assay.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![Benz[<I>g</I>]<WBR>isoquinoline-<WBR>5,10-<WBR>dione](https://img.chemicalbook.com/CAS/GIF/46492-08-4.gif)




