A1709112
4-Bromo-<I>N</I>,<I>N</I>-<WBR>bis(trimethylsilyl)<WBR>aniline , 95% , 5089-33-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB592.80 | In Stock |
|
| 25ML | RMB2044.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 156-158 °C/23 mmHg (lit.) |
| Density | 1.121 g/mL at 25 °C (lit.) |
| refractive index | 1.514 |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| pka | 5.54±0.50(Predicted) |
| Specific Gravity | 1.121 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| InChI | InChI=1S/C12H22BrNSi2/c1-15(2,3)14(16(4,5)6)12-9-7-11(13)8-10-12/h7-10H,1-6H3 |
| InChIKey | YJYMZGDBOMZWSR-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)N(C1=CC=C(Br)C=C1)[Si](C)(C)C |
Description and Uses
4-Bromo-N,N-bis(trimethylsilyl)aniline is an N-protected aryl reagent used in the synthesis of:
- Hydrophilic conjugated porphyrin dimers for one-photon and two-photon photodynamic therapy.
- Functionalized organometallic polymer, poly(ferrocenylsilane).
- Borylanilines such as 4-(dimesitylboryl)aniline and 4-(dimesitylboryl)-3,5-dimethylaniline.
- Silicon-containing oligomeric poly(imido-amides) (PIAs).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29319090 |





