A1724312
5-bromo-6-fluoro-1H-indazole , 97% , 105391-70-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB153.60 | In Stock |
|
| 1G | RMB407.20 | In Stock |
|
| 5g | RMB1535.20 | In Stock |
|
| 25g | RMB4559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 332.2±22.0 °C(Predicted) |
| Density | 1.861 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 11.95±0.40(Predicted) |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C7H4BrFN2/c8-5-1-4-3-10-11-7(4)2-6(5)9/h1-3H,(H,10,11) |
| InChIKey | ZNNFNEIFQIAWNY-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Br)C(F)=C2)C=N1 |
Description and Uses
5-Bromo-6-fluoro-1H-indazole is used for optimization and biological evaluation of [(trifluoromethyl)phenyl]indazoles as TRPA1 antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P260-P280-P312 |
| HS Code | 2933998090 |
