![3-bromo-1H-pyrazolo[3,4-c]pyridine](https://img.chemicalbook.com/CAS/GIF/76006-13-8.gif)
A1802512
3-bromo-1H-pyrazolo[3,4-c]pyridine , 97% , 76006-13-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB249.60 | In Stock |
|
| 5g | RMB1008.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C |
| Boiling point: | 378.6±22.0 °C(Predicted) |
| Density | 1.894±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 8.76±0.40(Predicted) |
| color | Yellow |
| InChI | InChI=1S/C6H4BrN3/c7-6-4-1-2-8-3-5(4)9-10-6/h1-3H,(H,9,10) |
| InChIKey | ANQCOJNSEVIFFL-UHFFFAOYSA-N |
| SMILES | C1=NC=CC2C(Br)=NNC1=2 |
Description and Uses
3-Bromo-1H-pyrazolo[3,4-c]pyridine is a useful reactant for the synthesis of azaindazoles as Inhibitors of bacterial DNA Ligase.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 1 |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
