A1835112
Boc-arg(mtr)-oh , 95% , 102185-38-6
CAS NO.:102185-38-6
Empirical Formula: C21H34N4O7S
Molecular Weight: 486.58
MDL number: MFCD00057790
| Pack Size | Price | Stock | Quantity |
| 1G | RMB202.40 | In Stock |
|
| 5G | RMB620.80 | In Stock |
|
| 25G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Powder |
| pka | 3.95±0.21(Predicted) |
| color | White to off-ehite |
| Major Application | peptide synthesis |
| InChIKey | CXZHJRGYWGPJSD-HNNXBMFYSA-N |
| SMILES | [S](=O)(=O)(N\C(=[N+H]\CCC[C@H](NC(=O)OC(C)(C)C)C(=O)[O-])\N)c1c(c(c(cc1C)OC)C)C |
Description and Uses
The Mtr-guanidine protection of Arg is more easily cleaved with acid than the tosyl protection
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H351 |
| Precautionary statements | P201-P202-P261-P302+P352-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2935 90 90 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![N5-[[[(3,4-Dihydro-2,2,5,7,8-pentamethyl-2H-1-benzopyran-6-yl)sulfonyl]amino]iminomethyl]-N2-[(1,1-dimethylethoxy)carbonyl]-L-ornithine](https://img.chemicalbook.com/CAS/GIF/200125-12-8.gif)

