A1841112
2-Bromo-5-methoxypyridine , 98% , 105170-27-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB171.36 | In Stock |
|
| 25G | RMB642.24 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 22 °C |
| Boiling point: | 113 °C(Press: 59 Torr) |
| Density | 1.530±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | -2.22±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H6BrNO/c1-9-5-2-3-6(7)8-4-5/h2-4H,1H3 |
| InChIKey | WULVUFYZVYHTFX-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(OC)C=C1 |
| CAS DataBase Reference | 105170-27-2 |
Description and Uses
2-Bromo-5-methoxypyridine is a reagent used in preparation of tetrahydroisoquinoline amides as bronchodilators.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2933399990 |




![6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one](https://img.chemicalbook.com/CAS/GIF/337463-88-4.gif)

