A1941812
6-Bromo-1-chloroisoquinoline , 97% , 205055-63-6
CAS NO.：205055-63-6
Empirical Formula: C9H5BrClN
Molecular Weight: 242.5
MDL number: MFCD06738661
EINECS: 809-114-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB47.20 | In Stock |
|
| 1G | RMB156.00 | In Stock |
|
| 5G | RMB671.20 | In Stock |
|
| 25g | RMB2879.20 | In Stock |
|
| 100g | RMB8799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 349.5±22.0 °C(Predicted) |
| Density | 1.673 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 1.48±0.38(Predicted) |
| form | powder |
| color | Light yellow to yellow |
| InChI | InChI=1S/C9H5BrClN/c10-7-1-2-8-6(5-7)3-4-12-9(8)11/h1-5H |
| InChIKey | VOAHGGQULSSGQW-UHFFFAOYSA-N |
| SMILES | C1(Cl)C2=C(C=C(Br)C=C2)C=CN=1 |
Description and Uses
6-Bromo-1-chloroisoquinoline has been used as a reactant in the preparation of phenylimidazoles as Smoothened antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-38-41 |
| Safety Statements | 26-45 |
| RIDADR | UN2811 |
| HS Code | 2933499090 |
