A1975212
2-Bromo-5-fluoro-6-methylpyridine , 97% , 374633-38-2
CAS NO.:374633-38-2
Empirical Formula: C6H5BrFN
Molecular Weight: 190.01
MDL number: MFCD03095064
EINECS: 675-596-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB187.20 | In Stock |
|
| 10g | RMB372.00 | In Stock |
|
| 25G | RMB891.20 | In Stock |
|
| 100G | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-65°C |
| Boiling point: | 183.4±35.0 °C(Predicted) |
| Density | 1.592±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | -0.91±0.10(Predicted) |
| color | Brown |
| InChI | InChI=1S/C6H5BrFN/c1-4-5(8)2-3-6(7)9-4/h2-3H,1H3 |
| InChIKey | BFQONZCQHGIKIY-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(Br)=CC=C1F |
| CAS DataBase Reference | 374633-38-2(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-fluoro-6-methylpyridine could be used to synthesize LY3295668, which is a potent, orally active and highly specific Aurora-A kinase inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS02 |
| Signal word | Danger |
| Hazard statements | H315-H319-H225 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P337+P313-P305+P351+P338-P362+P364-P303+P361+P353-P332+P313-P403+P235 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-41-37/38-22 |
| Safety Statements | 26-36/37/39-36-39 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







