A2012412
4-Bromo-3-chloro-2-methylaniline , 96% , 627531-47-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB43.20 | In Stock |
|
| 5G | RMB163.20 | In Stock |
|
| 25G | RMB549.60 | In Stock |
|
| 100G | RMB1899.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55℃ |
| Boiling point: | 289.5±35.0 °C(Predicted) |
| Density | 1.619±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 2.69±0.10(Predicted) |
| color | Dark brown |
| InChI | InChI=1S/C7H7BrClN/c1-4-6(10)3-2-5(8)7(4)9/h2-3H,10H2,1H3 |
| InChIKey | IAWSZYHMEPZGKK-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C(Cl)=C1C |
Description and Uses
4-Bromo-3-chloro-2-methylaniline is used as a reagent for the preparation of indoxyl glycosides for the detection of glycosidase activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2921420090 |
