A2025512
2-Bromo-1-iodo-4-methylbenzene , 98% , 71838-16-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 10g | RMB81.60 | In Stock |
|
| 25G | RMB155.20 | In Stock |
|
| 100G | RMB477.60 | In Stock |
|
| 500g | RMB2281.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265-267 °C |
| Boiling point: | 133 °C |
| Density | 2,08 g/cm3 |
| refractive index | 1.65 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Brown |
| Specific Gravity | 2.08 |
| InChI | InChI=1S/C7H6BrI/c1-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| InChIKey | PLAKKSAFIZVHJP-UHFFFAOYSA-N |
| SMILES | C1(I)=CC=C(C)C=C1Br |
| CAS DataBase Reference | 71838-16-9(CAS DataBase Reference) |
Description and Uses
3-Bromo-4-iodotoluene, is an intermediate for the synthesis of more complex compounds. It is used for the copper-catalyzed synthesis of 2-Arylbenzoxazoles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
