A2039656
4-Boc-piperazine-2-carboxylicacid , 97% , 128019-59-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5g | RMB143.20 | In Stock |
|
| 25g | RMB468.80 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 231-239 °C |
| Boiling point: | 371.8±37.0 °C(Predicted) |
| Density | 1.193±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 2.20±0.20(Predicted) |
| form | powder or crystals |
| Appearance | White to off-white Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | 1S/C10H18N2O4/c1-10(2,3)16-9(15)12-5-4-11-7(6-12)8(13)14/h7,11H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | YRYAXQJXMBETAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)C(O)=O |
| CAS DataBase Reference | 128019-59-0(CAS DataBase Reference) |
Description and Uses
As active pharmaceutical drugs and intermediates possess different biological activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43-36 |
| Safety Statements | 26-36/37/39-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Sens. 1 |
