A2059312
Boc-val-n(och3)ch3 , 95% , 87694-52-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB488.80 | In Stock |
|
| 25G | RMB1533.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 235 °C(lit.) |
| Density | 1.46 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,2-8°C |
| form | Low Melting Solid or Liquid |
| pka | 11.11±0.46(Predicted) |
| color | White to pale yellow |
| optical activity | [α]23/D 18.5°, c = 1 in methanol |
| Major Application | peptide synthesis |
| InChI | InChI=1/C12H24N2O4/c1-8(2)9(10(15)14(6)17-7)13-11(16)18-12(3,4)5/h8-9H,1-7H3,(H,13,16)/t9-/s3 |
| InChIKey | RRBFCGUIFHFYQK-DJEYLCQNNA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@H](C(N(OC)C)=O)C(C)C |&1:8,r| |
Description and Uses
α-Amino Weinreb amide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H312-H315-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P280-P302+P352-P312-P322-P363-P501-P264-P280-P305+P351+P338-P337+P313P |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |






